About 2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline
2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline (PubChem CID 67041974) has the molecular formula C15H10ClF3N2
and a molecular weight of 310.71 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline |
| PubChem CID | 67041974 |
| Molecular Formula | C15H10ClF3N2 |
| Molecular Weight | 310.71 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline |
| SMILES | FC(F)(F)c1ccc2c(c1)NC(c1ccc(Cl)cc1)N=C2 |
| InChI | InChI=1S/C15H10ClF3N2/c16-12-5-2-9(3-6-12)14-20-8-10-1-4-11(15(17,18)19)7-13(10)21-14/h1-8,14,21H |
| InChIKey | YZCWPGUAZSLIKQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.71 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline?
The IUPAC name of 2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline (CID 67041974) is 2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline.
What is the SMILES notation for 2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline?
The canonical SMILES for 2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline is FC(F)(F)c1ccc2c(c1)NC(c1ccc(Cl)cc1)N=C2.
What is the InChIKey of 2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline?
The InChIKey is YZCWPGUAZSLIKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClF3N2/c16-12-5-2-9(3-6-12)14-20-8-10-1-4-11(15(17,18)19)7-13(10)21-14/h1-8,14,21H.
What are the key properties of 2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline?
2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline has a molecular weight of 310.71 g/mol, XLogP of 4.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-7-(trifluoromethyl)-1,2-dihydroquinazoline is sourced from PubChem (CID 67041974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).