2-chloroaniline;2-hydroxybutanedioic acid

C10H12ClNO5 — CID 67042082

IUPAC2-chloroaniline;2-hydroxybutanedioic acid
SMILESNc1ccccc1Cl.O=C(O)CC(O)C(=O)O
InChIInChI=1S/C6H6ClN.C4H6O5/c7-5-3-1-2-4-6(5)8;5-2(4(8)9)1-3(6)7/h1-4H,8H2;2,5H,1H2,(H,6,7)(H,8,9)
InChIKeyYQGZBJDUMRYNJD-UHFFFAOYSA-N
MW261.66 g/mol
LogP0.83
Rot. Bonds3

About 2-chloroaniline;2-hydroxybutanedioic acid

2-chloroaniline;2-hydroxybutanedioic acid (PubChem CID 67042082) has the molecular formula C10H12ClNO5 and a molecular weight of 261.66 g/mol. Its IUPAC name is 2-chloroaniline;2-hydroxybutanedioic acid.

Molecular Properties

Compound Name2-chloroaniline;2-hydroxybutanedioic acid
PubChem CID67042082
Molecular FormulaC10H12ClNO5
Molecular Weight261.66 g/mol
Exact Mass261.04
IUPAC Name2-chloroaniline;2-hydroxybutanedioic acid
SMILESNc1ccccc1Cl.O=C(O)CC(O)C(=O)O
InChIInChI=1S/C6H6ClN.C4H6O5/c7-5-3-1-2-4-6(5)8;5-2(4(8)9)1-3(6)7/h1-4H,8H2;2,5H,1H2,(H,6,7)(H,8,9)
InChIKeyYQGZBJDUMRYNJD-UHFFFAOYSA-N
XLogP0.83
TPSA120.85 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.66
LogP ≤ 50.83
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-chloroaniline;2-hydroxybutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloroaniline;2-hydroxybutanedioic acid?
The IUPAC name of 2-chloroaniline;2-hydroxybutanedioic acid (CID 67042082) is 2-chloroaniline;2-hydroxybutanedioic acid.
What is the SMILES notation for 2-chloroaniline;2-hydroxybutanedioic acid?
The canonical SMILES for 2-chloroaniline;2-hydroxybutanedioic acid is Nc1ccccc1Cl.O=C(O)CC(O)C(=O)O.
What is the InChIKey of 2-chloroaniline;2-hydroxybutanedioic acid?
The InChIKey is YQGZBJDUMRYNJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN.C4H6O5/c7-5-3-1-2-4-6(5)8;5-2(4(8)9)1-3(6)7/h1-4H,8H2;2,5H,1H2,(H,6,7)(H,8,9).
What are the key properties of 2-chloroaniline;2-hydroxybutanedioic acid?
2-chloroaniline;2-hydroxybutanedioic acid has a molecular weight of 261.66 g/mol, XLogP of 0.83, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroaniline;2-hydroxybutanedioic acid is sourced from PubChem (CID 67042082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).