About ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate
ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate (PubChem CID 67042122) has the molecular formula C24H21Br2O6P
and a molecular weight of 596.21 g/mol. Its IUPAC name is ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate.
Molecular Properties
| Compound Name | ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate |
| PubChem CID | 67042122 |
| Molecular Formula | C24H21Br2O6P |
| Molecular Weight | 596.21 g/mol |
| Exact Mass | 593.94 |
| IUPAC Name | ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate |
| SMILES | CCOC(=O)c1cccc(Cc2cc(Oc3c(Br)cc(C(C)(O)P=O)cc3Br)ccc2O)c1 |
| InChI | InChI=1S/C24H21Br2O6P/c1-3-31-23(28)15-6-4-5-14(9-15)10-16-11-18(7-8-21(16)27)32-22-19(25)12-17(13-20(22)26)24(2,29)33-30/h4-9,11-13,27,29H,3,10H2,1-2H3 |
| InChIKey | MTGCVQNEPBTPIT-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 596.21 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate?
The IUPAC name of ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate (CID 67042122) is ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate.
What is the SMILES notation for ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate?
The canonical SMILES for ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate is CCOC(=O)c1cccc(Cc2cc(Oc3c(Br)cc(C(C)(O)P=O)cc3Br)ccc2O)c1.
What is the InChIKey of ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate?
The InChIKey is MTGCVQNEPBTPIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21Br2O6P/c1-3-31-23(28)15-6-4-5-14(9-15)10-16-11-18(7-8-21(16)27)32-22-19(25)12-17(13-20(22)26)24(2,29)33-30/h4-9,11-13,27,29H,3,10H2,1-2H3.
What are the key properties of ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate?
ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate has a molecular weight of 596.21 g/mol, XLogP of 6.93, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[[5-[2,6-dibromo-4-(1-hydroxy-1-phosphorosoethyl)phenoxy]-2-hydroxyphenyl]methyl]benzoate is sourced from PubChem (CID 67042122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).