About 2,3-dimethylbenzenethiol;4-methylbenzenethiol
2,3-dimethylbenzenethiol;4-methylbenzenethiol (PubChem CID 67042315) has the molecular formula C15H18S2
and a molecular weight of 262.44 g/mol. Its IUPAC name is 2,3-dimethylbenzenethiol;4-methylbenzenethiol.
Molecular Properties
| Compound Name | 2,3-dimethylbenzenethiol;4-methylbenzenethiol |
| PubChem CID | 67042315 |
| Molecular Formula | C15H18S2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2,3-dimethylbenzenethiol;4-methylbenzenethiol |
| SMILES | Cc1ccc(S)cc1.Cc1cccc(S)c1C |
| InChI | InChI=1S/C8H10S.C7H8S/c1-6-4-3-5-8(9)7(6)2;1-6-2-4-7(8)5-3-6/h3-5,9H,1-2H3;2-5,8H,1H3 |
| InChIKey | WEDKYNHRBUKUHE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbenzenethiol;4-methylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbenzenethiol;4-methylbenzenethiol?
The IUPAC name of 2,3-dimethylbenzenethiol;4-methylbenzenethiol (CID 67042315) is 2,3-dimethylbenzenethiol;4-methylbenzenethiol.
What is the SMILES notation for 2,3-dimethylbenzenethiol;4-methylbenzenethiol?
The canonical SMILES for 2,3-dimethylbenzenethiol;4-methylbenzenethiol is Cc1ccc(S)cc1.Cc1cccc(S)c1C.
What is the InChIKey of 2,3-dimethylbenzenethiol;4-methylbenzenethiol?
The InChIKey is WEDKYNHRBUKUHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S.C7H8S/c1-6-4-3-5-8(9)7(6)2;1-6-2-4-7(8)5-3-6/h3-5,9H,1-2H3;2-5,8H,1H3.
What are the key properties of 2,3-dimethylbenzenethiol;4-methylbenzenethiol?
2,3-dimethylbenzenethiol;4-methylbenzenethiol has a molecular weight of 262.44 g/mol, XLogP of 4.88, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbenzenethiol;4-methylbenzenethiol is sourced from PubChem (CID 67042315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).