About 4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole
4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole (PubChem CID 67042384) has the molecular formula C10H12BrN3
and a molecular weight of 254.13 g/mol. Its IUPAC name is 4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole.
Molecular Properties
| Compound Name | 4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole |
| PubChem CID | 67042384 |
| Molecular Formula | C10H12BrN3 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole |
| SMILES | Cc1ccc(C)n1-c1nn(C)cc1Br |
| InChI | InChI=1S/C10H12BrN3/c1-7-4-5-8(2)14(7)10-9(11)6-13(3)12-10/h4-6H,1-3H3 |
| InChIKey | KZKFXTODEGAGMX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole?
The IUPAC name of 4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole (CID 67042384) is 4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole.
What is the SMILES notation for 4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole?
The canonical SMILES for 4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole is Cc1ccc(C)n1-c1nn(C)cc1Br.
What is the InChIKey of 4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole?
The InChIKey is KZKFXTODEGAGMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN3/c1-7-4-5-8(2)14(7)10-9(11)6-13(3)12-10/h4-6H,1-3H3.
What are the key properties of 4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole?
4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole has a molecular weight of 254.13 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-(2,5-dimethylpyrrol-1-yl)-1-methylpyrazole is sourced from PubChem (CID 67042384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).