C22H18ClFN6O3 — CID 67042492
1-(2-chloro-6-fluorophenyl)-2-[5-(2-ethyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)-2-nitrophenyl]ethanol (PubChem CID 67042492) has the molecular formula C22H18ClFN6O3 and a molecular weight of 468.88 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)-2-[5-(2-ethyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)-2-nitrophenyl]ethanol.
| Compound Name | 1-(2-chloro-6-fluorophenyl)-2-[5-(2-ethyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)-2-nitrophenyl]ethanol |
|---|---|
| PubChem CID | 67042492 |
| Molecular Formula | C22H18ClFN6O3 |
| Molecular Weight | 468.88 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)-2-[5-(2-ethyl-5-pyrazin-2-yl-1,2,4-triazol-3-yl)-2-nitrophenyl]ethanol |
| SMILES | CCn1nc(-c2cnccn2)nc1-c1ccc([N+](=O)[O-])c(CC(O)c2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C22H18ClFN6O3/c1-2-29-22(27-21(28-29)17-12-25-8-9-26-17)13-6-7-18(30(32)33)14(10-13)11-19(31)20-15(23)4-3-5-16(20)24/h3-10,12,19,31H,2,11H2,1H3 |
| InChIKey | IQPLEARHAZKLNC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.88 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|