About 1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide
1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide (PubChem CID 67042614) has the molecular formula C21H20N4O4S2
and a molecular weight of 456.55 g/mol. Its IUPAC name is 1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide.
Molecular Properties
| Compound Name | 1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide |
| PubChem CID | 67042614 |
| Molecular Formula | C21H20N4O4S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide |
| SMILES | NS(=O)(=O)C(CS(=O)(=O)Nc1ccc2[nH]nc(-c3ccccc3)c2c1)c1ccccc1 |
| InChI | InChI=1S/C21H20N4O4S2/c22-31(28,29)20(15-7-3-1-4-8-15)14-30(26,27)25-17-11-12-19-18(13-17)21(24-23-19)16-9-5-2-6-10-16/h1-13,20,25H,14H2,(H,23,24)(H2,22,28,29) |
| InChIKey | SDDFFUSXRNQBST-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide?
The IUPAC name of 1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide (CID 67042614) is 1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide.
What is the SMILES notation for 1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide?
The canonical SMILES for 1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide is NS(=O)(=O)C(CS(=O)(=O)Nc1ccc2[nH]nc(-c3ccccc3)c2c1)c1ccccc1.
What is the InChIKey of 1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide?
The InChIKey is SDDFFUSXRNQBST-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O4S2/c22-31(28,29)20(15-7-3-1-4-8-15)14-30(26,27)25-17-11-12-19-18(13-17)21(24-23-19)16-9-5-2-6-10-16/h1-13,20,25H,14H2,(H,23,24)(H2,22,28,29).
What are the key properties of 1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide?
1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide has a molecular weight of 456.55 g/mol, XLogP of 3.00, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N'-(3-phenyl-1H-indazol-5-yl)ethane-1,2-disulfonamide is sourced from PubChem (CID 67042614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).