About 2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide
2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide (PubChem CID 67042651) has the molecular formula C18H15Cl2FN4O3S
and a molecular weight of 457.31 g/mol. Its IUPAC name is 2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide.
Molecular Properties
| Compound Name | 2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide |
| PubChem CID | 67042651 |
| Molecular Formula | C18H15Cl2FN4O3S |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide |
| SMILES | NC(=O)c1cccc2cnc(-c3c(Cl)ccc(NS(=O)(=O)CCCF)c3Cl)nc12 |
| InChI | InChI=1S/C18H15Cl2FN4O3S/c19-12-5-6-13(25-29(27,28)8-2-7-21)15(20)14(12)18-23-9-10-3-1-4-11(17(22)26)16(10)24-18/h1,3-6,9,25H,2,7-8H2,(H2,22,26) |
| InChIKey | NUDGNZGQPALGPP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide?
The IUPAC name of 2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide (CID 67042651) is 2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide.
What is the SMILES notation for 2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide?
The canonical SMILES for 2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide is NC(=O)c1cccc2cnc(-c3c(Cl)ccc(NS(=O)(=O)CCCF)c3Cl)nc12.
What is the InChIKey of 2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide?
The InChIKey is NUDGNZGQPALGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15Cl2FN4O3S/c19-12-5-6-13(25-29(27,28)8-2-7-21)15(20)14(12)18-23-9-10-3-1-4-11(17(22)26)16(10)24-18/h1,3-6,9,25H,2,7-8H2,(H2,22,26).
What are the key properties of 2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide?
2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide has a molecular weight of 457.31 g/mol, XLogP of 3.80, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-dichloro-3-(3-fluoropropylsulfonylamino)phenyl]quinazoline-8-carboxamide is sourced from PubChem (CID 67042651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).