C20H25N5O5 — CID 67042786
[1-[1-[2-(1,3-dioxoisoindol-2-yl)oxybutyl]triazol-4-yl]-2,2-dimethylpropyl]carbamic acid (PubChem CID 67042786) has the molecular formula C20H25N5O5 and a molecular weight of 415.45 g/mol. Its IUPAC name is [1-[1-[2-(1,3-dioxoisoindol-2-yl)oxybutyl]triazol-4-yl]-2,2-dimethylpropyl]carbamic acid.
| Compound Name | [1-[1-[2-(1,3-dioxoisoindol-2-yl)oxybutyl]triazol-4-yl]-2,2-dimethylpropyl]carbamic acid |
|---|---|
| PubChem CID | 67042786 |
| Molecular Formula | C20H25N5O5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | [1-[1-[2-(1,3-dioxoisoindol-2-yl)oxybutyl]triazol-4-yl]-2,2-dimethylpropyl]carbamic acid |
| SMILES | CCC(Cn1cc(C(NC(=O)O)C(C)(C)C)nn1)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H25N5O5/c1-5-12(30-25-17(26)13-8-6-7-9-14(13)18(25)27)10-24-11-15(22-23-24)16(20(2,3)4)21-19(28)29/h6-9,11-12,16,21H,5,10H2,1-4H3,(H,28,29) |
| InChIKey | CZNHISVLSBGNRV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|