C20H24ClFN4O — CID 67043196
(3R)-1-tert-butyl-N-[5-chloro-4-(6-fluoro-2-pyridinyl)-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 67043196) has the molecular formula C20H24ClFN4O and a molecular weight of 390.89 g/mol. Its IUPAC name is (3R)-1-tert-butyl-N-[5-chloro-4-(6-fluoro-2-pyridinyl)-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-tert-butyl-N-[5-chloro-4-(6-fluoro-2-pyridinyl)-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 67043196 |
| Molecular Formula | C20H24ClFN4O |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (3R)-1-tert-butyl-N-[5-chloro-4-(6-fluoro-2-pyridinyl)-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | CC(C)(C)N1CCC[C@@H](C(=O)Nc2cc(-c3cccc(F)n3)c(Cl)cn2)C1 |
| InChI | InChI=1S/C20H24ClFN4O/c1-20(2,3)26-9-5-6-13(12-26)19(27)25-18-10-14(15(21)11-23-18)16-7-4-8-17(22)24-16/h4,7-8,10-11,13H,5-6,9,12H2,1-3H3,(H,23,25,27)/t13-/m1/s1 |
| InChIKey | UWWCGWAUHGXYSR-CYBMUJFWSA-N |
| XLogP | 4.39 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|