About 3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine
3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine (PubChem CID 67043371) has the molecular formula C11H12FNOS
and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine.
Molecular Properties
| Compound Name | 3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine |
| PubChem CID | 67043371 |
| Molecular Formula | C11H12FNOS |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine |
| SMILES | CSC1=NC(c2cccc(F)c2)COC1 |
| InChI | InChI=1S/C11H12FNOS/c1-15-11-7-14-6-10(13-11)8-3-2-4-9(12)5-8/h2-5,10H,6-7H2,1H3 |
| InChIKey | JQBLJKRBUQJNTI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine?
The IUPAC name of 3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine (CID 67043371) is 3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine.
What is the SMILES notation for 3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine?
The canonical SMILES for 3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine is CSC1=NC(c2cccc(F)c2)COC1.
What is the InChIKey of 3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine?
The InChIKey is JQBLJKRBUQJNTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNOS/c1-15-11-7-14-6-10(13-11)8-3-2-4-9(12)5-8/h2-5,10H,6-7H2,1H3.
What are the key properties of 3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine?
3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine has a molecular weight of 225.29 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluorophenyl)-5-methylsulfanyl-3,6-dihydro-2H-1,4-oxazine is sourced from PubChem (CID 67043371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).