About 3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide
3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide (PubChem CID 67043412) has the molecular formula C7H3ClFNO2S
and a molecular weight of 219.62 g/mol. Its IUPAC name is 3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide.
Molecular Properties
| Compound Name | 3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide |
| PubChem CID | 67043412 |
| Molecular Formula | C7H3ClFNO2S |
| Molecular Weight | 219.62 g/mol |
| Exact Mass | 218.96 |
| IUPAC Name | 3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=C(Cl)c2cccc(F)c21 |
| InChI | InChI=1S/C7H3ClFNO2S/c8-7-4-2-1-3-5(9)6(4)13(11,12)10-7/h1-3H |
| InChIKey | NGSNFRWBUXOCEM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.62 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide?
The IUPAC name of 3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide (CID 67043412) is 3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide.
What is the SMILES notation for 3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide?
The canonical SMILES for 3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide is O=S1(=O)N=C(Cl)c2cccc(F)c21.
What is the InChIKey of 3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide?
The InChIKey is NGSNFRWBUXOCEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClFNO2S/c8-7-4-2-1-3-5(9)6(4)13(11,12)10-7/h1-3H.
What are the key properties of 3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide?
3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide has a molecular weight of 219.62 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-7-fluoro-1,2-benzothiazole 1,1-dioxide is sourced from PubChem (CID 67043412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).