About [2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid
[2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid (PubChem CID 67043512) has the molecular formula C23H30BrNO3
and a molecular weight of 448.40 g/mol. Its IUPAC name is [2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid.
Molecular Properties
| Compound Name | [2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid |
| PubChem CID | 67043512 |
| Molecular Formula | C23H30BrNO3 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | [2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid |
| SMILES | CC(C)(C)C(C)(c1ccc(Br)cc1)N(CCCC(O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H30BrNO3/c1-22(2,3)23(4,18-12-14-19(24)15-13-18)25(21(27)28)16-8-11-20(26)17-9-6-5-7-10-17/h5-7,9-10,12-15,20,26H,8,11,16H2,1-4H3,(H,27,28) |
| InChIKey | QESQGCLDYIOKJJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid?
The IUPAC name of [2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid (CID 67043512) is [2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid.
What is the SMILES notation for [2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid?
The canonical SMILES for [2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid is CC(C)(C)C(C)(c1ccc(Br)cc1)N(CCCC(O)c1ccccc1)C(=O)O.
What is the InChIKey of [2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid?
The InChIKey is QESQGCLDYIOKJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30BrNO3/c1-22(2,3)23(4,18-12-14-19(24)15-13-18)25(21(27)28)16-8-11-20(26)17-9-6-5-7-10-17/h5-7,9-10,12-15,20,26H,8,11,16H2,1-4H3,(H,27,28).
What are the key properties of [2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid?
[2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid has a molecular weight of 448.40 g/mol, XLogP of 6.20, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromophenyl)-3,3-dimethylbutan-2-yl]-(4-hydroxy-4-phenylbutyl)carbamic acid is sourced from PubChem (CID 67043512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).