About 3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one
3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one (PubChem CID 67043563) has the molecular formula C22H21BrF2O2
and a molecular weight of 435.31 g/mol. Its IUPAC name is 3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one.
Molecular Properties
| Compound Name | 3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one |
| PubChem CID | 67043563 |
| Molecular Formula | C22H21BrF2O2 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one |
| SMILES | O=C1c2cc(Br)ccc2C(Cc2ccccc2)C12CCC(OC(F)F)CC2 |
| InChI | InChI=1S/C22H21BrF2O2/c23-15-6-7-17-18(13-15)20(26)22(10-8-16(9-11-22)27-21(24)25)19(17)12-14-4-2-1-3-5-14/h1-7,13,16,19,21H,8-12H2 |
| InChIKey | SOQPCMYYXWIYBU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one?
The IUPAC name of 3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one (CID 67043563) is 3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one.
What is the SMILES notation for 3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one?
The canonical SMILES for 3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one is O=C1c2cc(Br)ccc2C(Cc2ccccc2)C12CCC(OC(F)F)CC2.
What is the InChIKey of 3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one?
The InChIKey is SOQPCMYYXWIYBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21BrF2O2/c23-15-6-7-17-18(13-15)20(26)22(10-8-16(9-11-22)27-21(24)25)19(17)12-14-4-2-1-3-5-14/h1-7,13,16,19,21H,8-12H2.
What are the key properties of 3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one?
3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one has a molecular weight of 435.31 g/mol, XLogP of 6.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-6-bromo-4'-(difluoromethoxy)spiro[3H-indene-2,1'-cyclohexane]-1-one is sourced from PubChem (CID 67043563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).