C23H22ClFN6O2 — CID 67043634
2-[3-[4-chloro-3-[[5-(4-fluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-3-yl]amino]phenyl]-5-methylpyrazol-1-yl]ethanol (PubChem CID 67043634) has the molecular formula C23H22ClFN6O2 and a molecular weight of 468.92 g/mol. Its IUPAC name is 2-[3-[4-chloro-3-[[5-(4-fluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-3-yl]amino]phenyl]-5-methylpyrazol-1-yl]ethanol.
| Compound Name | 2-[3-[4-chloro-3-[[5-(4-fluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-3-yl]amino]phenyl]-5-methylpyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 67043634 |
| Molecular Formula | C23H22ClFN6O2 |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-[3-[4-chloro-3-[[5-(4-fluorophenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-3-yl]amino]phenyl]-5-methylpyrazol-1-yl]ethanol |
| SMILES | Cc1cc(-c2ccc(Cl)c(Nc3nnc4n3C(c3ccc(F)cc3)COC4)c2)nn1CCO |
| InChI | InChI=1S/C23H22ClFN6O2/c1-14-10-19(29-30(14)8-9-32)16-4-7-18(24)20(11-16)26-23-28-27-22-13-33-12-21(31(22)23)15-2-5-17(25)6-3-15/h2-7,10-11,21,32H,8-9,12-13H2,1H3,(H,26,28) |
| InChIKey | JXHYJDFCHJALRT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |