C28H31ClFN5O3 — CID 67043980
butyl 3-[[5-chloro-4-[6-[(3-fluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 67043980) has the molecular formula C28H31ClFN5O3 and a molecular weight of 540.04 g/mol. Its IUPAC name is butyl 3-[[5-chloro-4-[6-[(3-fluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | butyl 3-[[5-chloro-4-[6-[(3-fluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67043980 |
| Molecular Formula | C28H31ClFN5O3 |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | butyl 3-[[5-chloro-4-[6-[(3-fluorophenyl)methylamino]-2-pyridinyl]-2-pyridinyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCCC(C(=O)Nc2cc(-c3cccc(NCc4cccc(F)c4)n3)c(Cl)cn2)C1 |
| InChI | InChI=1S/C28H31ClFN5O3/c1-2-3-13-38-28(37)35-12-6-8-20(18-35)27(36)34-26-15-22(23(29)17-32-26)24-10-5-11-25(33-24)31-16-19-7-4-9-21(30)14-19/h4-5,7,9-11,14-15,17,20H,2-3,6,8,12-13,16,18H2,1H3,(H,31,33)(H,32,34,36) |
| InChIKey | YXPFIXFEQVMWLT-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|