C19H15N3O4 — CID 67044172
4-amino-3-phenoxy-2-(pyridine-2-carbonylamino)benzoic acid (PubChem CID 67044172) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 4-amino-3-phenoxy-2-(pyridine-2-carbonylamino)benzoic acid.
| Compound Name | 4-amino-3-phenoxy-2-(pyridine-2-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 67044172 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-amino-3-phenoxy-2-(pyridine-2-carbonylamino)benzoic acid |
| SMILES | Nc1ccc(C(=O)O)c(NC(=O)c2ccccn2)c1Oc1ccccc1 |
| InChI | InChI=1S/C19H15N3O4/c20-14-10-9-13(19(24)25)16(17(14)26-12-6-2-1-3-7-12)22-18(23)15-8-4-5-11-21-15/h1-11H,20H2,(H,22,23)(H,24,25) |
| InChIKey | LGQZKCZYYSOCTI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|