2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid

C13H12O3 — CID 67045099

IUPAC2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid
SMILESCC(=Cc1ccc2c(c1)CCC2=O)C(=O)O
InChIInChI=1S/C13H12O3/c1-8(13(15)16)6-9-2-4-11-10(7-9)3-5-12(11)14/h2,4,6-7H,3,5H2,1H3,(H,15,16)
InChIKeyJEIDYAXPZPDQIW-UHFFFAOYSA-N
MW216.24 g/mol
LogP2.30
Rot. Bonds2

About 2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid

2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid (PubChem CID 67045099) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid.

Molecular Properties

Compound Name2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid
PubChem CID67045099
Molecular FormulaC13H12O3
Molecular Weight216.24 g/mol
Exact Mass216.08
IUPAC Name2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid
SMILESCC(=Cc1ccc2c(c1)CCC2=O)C(=O)O
InChIInChI=1S/C13H12O3/c1-8(13(15)16)6-9-2-4-11-10(7-9)3-5-12(11)14/h2,4,6-7H,3,5H2,1H3,(H,15,16)
InChIKeyJEIDYAXPZPDQIW-UHFFFAOYSA-N
XLogP2.30
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.24
LogP ≤ 52.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid?
The IUPAC name of 2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid (CID 67045099) is 2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid.
What is the SMILES notation for 2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid?
The canonical SMILES for 2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid is CC(=Cc1ccc2c(c1)CCC2=O)C(=O)O.
What is the InChIKey of 2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid?
The InChIKey is JEIDYAXPZPDQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O3/c1-8(13(15)16)6-9-2-4-11-10(7-9)3-5-12(11)14/h2,4,6-7H,3,5H2,1H3,(H,15,16).
What are the key properties of 2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid?
2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid has a molecular weight of 216.24 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(1-oxo-2,3-dihydroinden-5-yl)prop-2-enoic acid is sourced from PubChem (CID 67045099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).