C13H15FO4 — CID 67045674
8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 67045674) has the molecular formula C13H15FO4 and a molecular weight of 254.26 g/mol. Its IUPAC name is 8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | 8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 67045674 |
| Molecular Formula | C13H15FO4 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | OC1COC2COC(c3ccccc3)OC2C1F |
| InChI | InChI=1S/C13H15FO4/c14-11-9(15)6-16-10-7-17-13(18-12(10)11)8-4-2-1-3-5-8/h1-5,9-13,15H,6-7H2 |
| InChIKey | DRZILFBDKUOTIC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |