About 1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine
1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine (PubChem CID 67046003) has the molecular formula C13H16ClF3N2
and a molecular weight of 292.73 g/mol. Its IUPAC name is 1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine |
| PubChem CID | 67046003 |
| Molecular Formula | C13H16ClF3N2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine |
| SMILES | CC1CN(c2ccc(C(F)(F)F)c(Cl)c2)CC(C)N1 |
| InChI | InChI=1S/C13H16ClF3N2/c1-8-6-19(7-9(2)18-8)10-3-4-11(12(14)5-10)13(15,16)17/h3-5,8-9,18H,6-7H2,1-2H3 |
| InChIKey | HPMHMZDKAXGTJN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine?
The IUPAC name of 1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine (CID 67046003) is 1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine.
What is the SMILES notation for 1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine?
The canonical SMILES for 1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine is CC1CN(c2ccc(C(F)(F)F)c(Cl)c2)CC(C)N1.
What is the InChIKey of 1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine?
The InChIKey is HPMHMZDKAXGTJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClF3N2/c1-8-6-19(7-9(2)18-8)10-3-4-11(12(14)5-10)13(15,16)17/h3-5,8-9,18H,6-7H2,1-2H3.
What are the key properties of 1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine?
1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine has a molecular weight of 292.73 g/mol, XLogP of 3.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-chloro-4-(trifluoromethyl)phenyl]-3,5-dimethylpiperazine is sourced from PubChem (CID 67046003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).