C6H10N2O2 — CID 67046199
3,4-dimethyl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 67046199) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is 3,4-dimethyl-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | 3,4-dimethyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 67046199 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 3,4-dimethyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CC1=NOC(C(N)=O)C1C |
| InChI | InChI=1S/C6H10N2O2/c1-3-4(2)8-10-5(3)6(7)9/h3,5H,1-2H3,(H2,7,9) |
| InChIKey | WTNNIBQFEXNDQZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |