About CID 67046201
CID 67046201 (PubChem CID 67046201) has the molecular formula C12H23OSi
and a molecular weight of 211.40 g/mol.
Molecular Properties
| Compound Name | CID 67046201 |
| PubChem CID | 67046201 |
| Molecular Formula | C12H23OSi |
| Molecular Weight | 211.40 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC=C[C@@H](C1CC1)C(C)(C)C |
| InChI | InChI=1S/C12H23OSi/c1-12(2,3)11(10-6-7-10)8-9-13-14(4)5/h8-11H,6-7H2,1-5H3/t11-/m0/s1 |
| InChIKey | AWKAKBKKXCIFQL-NSHDSACASA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67046201 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67046201?
The IUPAC name of CID 67046201 (CID 67046201) is not available.
What is the SMILES notation for CID 67046201?
The canonical SMILES for CID 67046201 is C[Si](C)OC=C[C@@H](C1CC1)C(C)(C)C.
What is the InChIKey of CID 67046201?
The InChIKey is AWKAKBKKXCIFQL-NSHDSACASA-N. The full InChI is InChI=1S/C12H23OSi/c1-12(2,3)11(10-6-7-10)8-9-13-14(4)5/h8-11H,6-7H2,1-5H3/t11-/m0/s1.
What are the key properties of CID 67046201?
CID 67046201 has a molecular weight of 211.40 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67046201 is sourced from PubChem (CID 67046201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).