methyl 2-(4,4-difluoropiperidin-1-yl)acetate

C8H13F2NO2 — CID 67047003

IUPACmethyl 2-(4,4-difluoropiperidin-1-yl)acetate
SMILESCOC(=O)CN1CCC(F)(F)CC1
InChIInChI=1S/C8H13F2NO2/c1-13-7(12)6-11-4-2-8(9,10)3-5-11/h2-6H2,1H3
InChIKeyFXAPZTYFPVGUAN-UHFFFAOYSA-N
MW193.19 g/mol
LogP0.89
Rot. Bonds2

About methyl 2-(4,4-difluoropiperidin-1-yl)acetate

methyl 2-(4,4-difluoropiperidin-1-yl)acetate (PubChem CID 67047003) has the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. Its IUPAC name is methyl 2-(4,4-difluoropiperidin-1-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(4,4-difluoropiperidin-1-yl)acetate
PubChem CID67047003
Molecular FormulaC8H13F2NO2
Molecular Weight193.19 g/mol
Exact Mass193.09
IUPAC Namemethyl 2-(4,4-difluoropiperidin-1-yl)acetate
SMILESCOC(=O)CN1CCC(F)(F)CC1
InChIInChI=1S/C8H13F2NO2/c1-13-7(12)6-11-4-2-8(9,10)3-5-11/h2-6H2,1H3
InChIKeyFXAPZTYFPVGUAN-UHFFFAOYSA-N
XLogP0.89
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.19
LogP ≤ 50.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-(4,4-difluoropiperidin-1-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4,4-difluoropiperidin-1-yl)acetate?
The IUPAC name of methyl 2-(4,4-difluoropiperidin-1-yl)acetate (CID 67047003) is methyl 2-(4,4-difluoropiperidin-1-yl)acetate.
What is the SMILES notation for methyl 2-(4,4-difluoropiperidin-1-yl)acetate?
The canonical SMILES for methyl 2-(4,4-difluoropiperidin-1-yl)acetate is COC(=O)CN1CCC(F)(F)CC1.
What is the InChIKey of methyl 2-(4,4-difluoropiperidin-1-yl)acetate?
The InChIKey is FXAPZTYFPVGUAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO2/c1-13-7(12)6-11-4-2-8(9,10)3-5-11/h2-6H2,1H3.
What are the key properties of methyl 2-(4,4-difluoropiperidin-1-yl)acetate?
methyl 2-(4,4-difluoropiperidin-1-yl)acetate has a molecular weight of 193.19 g/mol, XLogP of 0.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4,4-difluoropiperidin-1-yl)acetate is sourced from PubChem (CID 67047003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).