C11H18FNO4 — CID 67047423
tert-butyl 6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 67047423) has the molecular formula C11H18FNO4 and a molecular weight of 247.27 g/mol. Its IUPAC name is tert-butyl 6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl 6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 67047423 |
| Molecular Formula | C11H18FNO4 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | tert-butyl 6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)C2OCC(O)C21 |
| InChI | InChI=1S/C11H18FNO4/c1-11(2,3)17-10(15)13-4-6(12)9-8(13)7(14)5-16-9/h6-9,14H,4-5H2,1-3H3 |
| InChIKey | XSIZFSDWJSSDOG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |