C11H13N3O4 — CID 67047784
2,2-dimethyl-5-[[(1-methylpyrazol-3-yl)amino]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 67047784) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[(1-methylpyrazol-3-yl)amino]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[(1-methylpyrazol-3-yl)amino]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 67047784 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2,2-dimethyl-5-[[(1-methylpyrazol-3-yl)amino]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | Cn1ccc(NC=C2C(=O)OC(C)(C)OC2=O)n1 |
| InChI | InChI=1S/C11H13N3O4/c1-11(2)17-9(15)7(10(16)18-11)6-12-8-4-5-14(3)13-8/h4-6H,1-3H3,(H,12,13) |
| InChIKey | FLJCNOWRDWAZCR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|