About 2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid
2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid (PubChem CID 67047913) has the molecular formula C10H8O2S
and a molecular weight of 192.24 g/mol. Its IUPAC name is 2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid.
Molecular Properties
| Compound Name | 2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid |
| PubChem CID | 67047913 |
| Molecular Formula | C10H8O2S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid |
| SMILES | O=C(O)C1C2=C1C1C=CC=CC1S2 |
| InChI | InChI=1S/C10H8O2S/c11-10(12)8-7-5-3-1-2-4-6(5)13-9(7)8/h1-6,8H,(H,11,12) |
| InChIKey | QRQTVGLSOJWDRV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid?
The IUPAC name of 2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid (CID 67047913) is 2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid.
What is the SMILES notation for 2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid?
The canonical SMILES for 2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid is O=C(O)C1C2=C1C1C=CC=CC1S2.
What is the InChIKey of 2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid?
The InChIKey is QRQTVGLSOJWDRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2S/c11-10(12)8-7-5-3-1-2-4-6(5)13-9(7)8/h1-6,8H,(H,11,12).
What are the key properties of 2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid?
2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid has a molecular weight of 192.24 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2a,6a-dihydro-1H-cyclopropa[b][1]benzothiole-1-carboxylic acid is sourced from PubChem (CID 67047913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).