C8H11F2NO4 — CID 67048778
6-(difluoromethyl)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylic acid (PubChem CID 67048778) has the molecular formula C8H11F2NO4 and a molecular weight of 223.17 g/mol. Its IUPAC name is 6-(difluoromethyl)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylic acid.
| Compound Name | 6-(difluoromethyl)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylic acid |
|---|---|
| PubChem CID | 67048778 |
| Molecular Formula | C8H11F2NO4 |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 6-(difluoromethyl)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylic acid |
| SMILES | O=C(O)N1CC(C(F)F)C2OCC(O)C21 |
| InChI | InChI=1S/C8H11F2NO4/c9-7(10)3-1-11(8(13)14)5-4(12)2-15-6(3)5/h3-7,12H,1-2H2,(H,13,14) |
| InChIKey | OBWQDVBBUQFIIW-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |