About [(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate
[(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate (PubChem CID 67048941) has the molecular formula C15H17F2NO3
and a molecular weight of 297.30 g/mol. Its IUPAC name is [(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate.
Molecular Properties
| Compound Name | [(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate |
| PubChem CID | 67048941 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate |
| SMILES | NC(=O)OC[C@H]([C@@H]1C=CCO1)C(F)(F)Cc1ccccc1 |
| InChI | InChI=1S/C15H17F2NO3/c16-15(17,9-11-5-2-1-3-6-11)12(10-21-14(18)19)13-7-4-8-20-13/h1-7,12-13H,8-10H2,(H2,18,19)/t12-,13+/m1/s1 |
| InChIKey | XCBSNSFSUYAZIG-OLZOCXBDSA-N |
| XLogP | 2.53 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate?
The IUPAC name of [(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate (CID 67048941) is [(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate.
What is the SMILES notation for [(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate?
The canonical SMILES for [(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate is NC(=O)OC[C@H]([C@@H]1C=CCO1)C(F)(F)Cc1ccccc1.
What is the InChIKey of [(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate?
The InChIKey is XCBSNSFSUYAZIG-OLZOCXBDSA-N. The full InChI is InChI=1S/C15H17F2NO3/c16-15(17,9-11-5-2-1-3-6-11)12(10-21-14(18)19)13-7-4-8-20-13/h1-7,12-13H,8-10H2,(H2,18,19)/t12-,13+/m1/s1.
What are the key properties of [(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate?
[(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate has a molecular weight of 297.30 g/mol, XLogP of 2.53, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoro-4-phenylbutyl] carbamate is sourced from PubChem (CID 67048941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).