About [3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate
[3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate (PubChem CID 67048942) has the molecular formula C15H17F2NO3
and a molecular weight of 297.30 g/mol. Its IUPAC name is [3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate.
Molecular Properties
| Compound Name | [3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate |
| PubChem CID | 67048942 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate |
| SMILES | NC(=O)OC(Cc1ccccc1)C(C(F)F)C1C=CCO1 |
| InChI | InChI=1S/C15H17F2NO3/c16-14(17)13(11-7-4-8-20-11)12(21-15(18)19)9-10-5-2-1-3-6-10/h1-7,11-14H,8-9H2,(H2,18,19) |
| InChIKey | RFTAHARZTZZCDH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate?
The IUPAC name of [3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate (CID 67048942) is [3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate.
What is the SMILES notation for [3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate?
The canonical SMILES for [3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate is NC(=O)OC(Cc1ccccc1)C(C(F)F)C1C=CCO1.
What is the InChIKey of [3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate?
The InChIKey is RFTAHARZTZZCDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2NO3/c16-14(17)13(11-7-4-8-20-11)12(21-15(18)19)9-10-5-2-1-3-6-10/h1-7,11-14H,8-9H2,(H2,18,19).
What are the key properties of [3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate?
[3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate has a molecular weight of 297.30 g/mol, XLogP of 2.53, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,5-dihydrofuran-2-yl)-4,4-difluoro-1-phenylbutan-2-yl] carbamate is sourced from PubChem (CID 67048942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).