About 5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid
5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid (PubChem CID 67049258) has the molecular formula C22H16Cl2N2O2
and a molecular weight of 411.29 g/mol. Its IUPAC name is 5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid.
Molecular Properties
| Compound Name | 5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid |
| PubChem CID | 67049258 |
| Molecular Formula | C22H16Cl2N2O2 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid |
| SMILES | O=C(O)CCC#Cc1ccc(C=Cc2ncc(-c3ccc(Cl)cc3Cl)[nH]2)cc1 |
| InChI | InChI=1S/C22H16Cl2N2O2/c23-17-10-11-18(19(24)13-17)20-14-25-21(26-20)12-9-16-7-5-15(6-8-16)3-1-2-4-22(27)28/h5-14H,2,4H2,(H,25,26)(H,27,28) |
| InChIKey | SAQNGUFELUFUBL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid?
The IUPAC name of 5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid (CID 67049258) is 5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid.
What is the SMILES notation for 5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid?
The canonical SMILES for 5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid is O=C(O)CCC#Cc1ccc(C=Cc2ncc(-c3ccc(Cl)cc3Cl)[nH]2)cc1.
What is the InChIKey of 5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid?
The InChIKey is SAQNGUFELUFUBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16Cl2N2O2/c23-17-10-11-18(19(24)13-17)20-14-25-21(26-20)12-9-16-7-5-15(6-8-16)3-1-2-4-22(27)28/h5-14H,2,4H2,(H,25,26)(H,27,28).
What are the key properties of 5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid?
5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid has a molecular weight of 411.29 g/mol, XLogP of 5.77, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[2-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]ethenyl]phenyl]pent-4-ynoic acid is sourced from PubChem (CID 67049258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).