C13H24O3Si — CID 67049908
[(3R,3aR,6aR)-6-methylidene-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 67049908) has the molecular formula C13H24O3Si and a molecular weight of 256.42 g/mol. Its IUPAC name is [(3R,3aR,6aR)-6-methylidene-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,3aR,6aR)-6-methylidene-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 67049908 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | [(3R,3aR,6aR)-6-methylidene-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C1CO[C@@H]2[C@@H]1OC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H24O3Si/c1-9-7-14-12-10(8-15-11(9)12)16-17(5,6)13(2,3)4/h10-12H,1,7-8H2,2-6H3/t10-,11-,12+/m1/s1 |
| InChIKey | SXUKLLWDFDRBHA-UTUOFQBUSA-N |
| XLogP | 2.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|