C13H20O5 — CID 67050080
(3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) hept-6-enoate (PubChem CID 67050080) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) hept-6-enoate.
| Compound Name | (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) hept-6-enoate |
|---|---|
| PubChem CID | 67050080 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) hept-6-enoate |
| SMILES | C=CCCCCC(=O)OC1COC2C(O)COC12 |
| InChI | InChI=1S/C13H20O5/c1-2-3-4-5-6-11(15)18-10-8-17-12-9(14)7-16-13(10)12/h2,9-10,12-14H,1,3-8H2 |
| InChIKey | HQGKKZZRLZXGAX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|