C26H29ClF2N2O3 — CID 67050149
methyl 6-[2-[4-chloro-2-(cyclopentylmethoxy)phenyl]-5,6-difluorobenzimidazol-1-yl]hexanoate (PubChem CID 67050149) has the molecular formula C26H29ClF2N2O3 and a molecular weight of 490.98 g/mol. Its IUPAC name is methyl 6-[2-[4-chloro-2-(cyclopentylmethoxy)phenyl]-5,6-difluorobenzimidazol-1-yl]hexanoate.
| Compound Name | methyl 6-[2-[4-chloro-2-(cyclopentylmethoxy)phenyl]-5,6-difluorobenzimidazol-1-yl]hexanoate |
|---|---|
| PubChem CID | 67050149 |
| Molecular Formula | C26H29ClF2N2O3 |
| Molecular Weight | 490.98 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | methyl 6-[2-[4-chloro-2-(cyclopentylmethoxy)phenyl]-5,6-difluorobenzimidazol-1-yl]hexanoate |
| SMILES | COC(=O)CCCCCn1c(-c2ccc(Cl)cc2OCC2CCCC2)nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C26H29ClF2N2O3/c1-33-25(32)9-3-2-6-12-31-23-15-21(29)20(28)14-22(23)30-26(31)19-11-10-18(27)13-24(19)34-16-17-7-4-5-8-17/h10-11,13-15,17H,2-9,12,16H2,1H3 |
| InChIKey | LYRDPFTUNBGSBG-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.98 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|