About manganese;2H-porphyrin-2-ide
manganese;2H-porphyrin-2-ide (PubChem CID 67050440) has the molecular formula C20H11MnN4-
and a molecular weight of 362.27 g/mol. Its IUPAC name is manganese;2H-porphyrin-2-ide.
Molecular Properties
| Compound Name | manganese;2H-porphyrin-2-ide |
| PubChem CID | 67050440 |
| Molecular Formula | C20H11MnN4- |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | manganese;2H-porphyrin-2-ide |
| SMILES | [C-]1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N\C(=C/2)C=C4)C=C3)C=C1.[Mn] |
| InChI | InChI=1S/C20H11N4.Mn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;/h1-7,9-12H;/q-1;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-; |
| InChIKey | VCCYNXJZEFJCST-QDJBTJTOSA-N |
| XLogP | 3.38 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze manganese;2H-porphyrin-2-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese;2H-porphyrin-2-ide?
The IUPAC name of manganese;2H-porphyrin-2-ide (CID 67050440) is manganese;2H-porphyrin-2-ide.
What is the SMILES notation for manganese;2H-porphyrin-2-ide?
The canonical SMILES for manganese;2H-porphyrin-2-ide is [C-]1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N\C(=C/2)C=C4)C=C3)C=C1.[Mn].
What is the InChIKey of manganese;2H-porphyrin-2-ide?
The InChIKey is VCCYNXJZEFJCST-QDJBTJTOSA-N. The full InChI is InChI=1S/C20H11N4.Mn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;/h1-7,9-12H;/q-1;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;.
What are the key properties of manganese;2H-porphyrin-2-ide?
manganese;2H-porphyrin-2-ide has a molecular weight of 362.27 g/mol, XLogP of 3.38, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for manganese;2H-porphyrin-2-ide is sourced from PubChem (CID 67050440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).