C22H27N5OS — CID 67050642
2-(5-methyl-2-propan-2-yl-1,2,4-triazol-3-yl)-8-[(3R)-piperidin-3-yl]-4,5-dihydro-[1]benzoxepino[5,4-d][1,3]thiazole (PubChem CID 67050642) has the molecular formula C22H27N5OS and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-(5-methyl-2-propan-2-yl-1,2,4-triazol-3-yl)-8-[(3R)-piperidin-3-yl]-4,5-dihydro-[1]benzoxepino[5,4-d][1,3]thiazole.
| Compound Name | 2-(5-methyl-2-propan-2-yl-1,2,4-triazol-3-yl)-8-[(3R)-piperidin-3-yl]-4,5-dihydro-[1]benzoxepino[5,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 67050642 |
| Molecular Formula | C22H27N5OS |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-(5-methyl-2-propan-2-yl-1,2,4-triazol-3-yl)-8-[(3R)-piperidin-3-yl]-4,5-dihydro-[1]benzoxepino[5,4-d][1,3]thiazole |
| SMILES | Cc1nc(-c2nc3c(s2)CCOc2cc([C@H]4CCCNC4)ccc2-3)n(C(C)C)n1 |
| InChI | InChI=1S/C22H27N5OS/c1-13(2)27-21(24-14(3)26-27)22-25-20-17-7-6-15(16-5-4-9-23-12-16)11-18(17)28-10-8-19(20)29-22/h6-7,11,13,16,23H,4-5,8-10,12H2,1-3H3/t16-/m0/s1 |
| InChIKey | CWKMTAPIKIHWGB-INIZCTEOSA-N |
| XLogP | 4.36 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |