About 1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride
1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride (PubChem CID 67050714) has the molecular formula C9H18ClN2+
and a molecular weight of 189.71 g/mol. Its IUPAC name is 1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride.
Molecular Properties
| Compound Name | 1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride |
| PubChem CID | 67050714 |
| Molecular Formula | C9H18ClN2+ |
| Molecular Weight | 189.71 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride |
| SMILES | CC(C)[N+]1(C(C)C)C=CN=C1.Cl |
| InChI | InChI=1S/C9H17N2.ClH/c1-8(2)11(9(3)4)6-5-10-7-11;/h5-9H,1-4H3;1H/q+1; |
| InChIKey | BSOKPVQEHWZAIL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.71 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride?
The IUPAC name of 1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride (CID 67050714) is 1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride.
What is the SMILES notation for 1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride?
The canonical SMILES for 1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride is CC(C)[N+]1(C(C)C)C=CN=C1.Cl.
What is the InChIKey of 1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride?
The InChIKey is BSOKPVQEHWZAIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N2.ClH/c1-8(2)11(9(3)4)6-5-10-7-11;/h5-9H,1-4H3;1H/q+1;.
What are the key properties of 1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride?
1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride has a molecular weight of 189.71 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-di(propan-2-yl)imidazol-1-ium;hydrochloride is sourced from PubChem (CID 67050714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).