C20H24N6O3 — CID 67050878
3-[[7-(cyclopropylamino)-5-[(4-hydroxycyclohexyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 67050878) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-[[7-(cyclopropylamino)-5-[(4-hydroxycyclohexyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-[[7-(cyclopropylamino)-5-[(4-hydroxycyclohexyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67050878 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 3-[[7-(cyclopropylamino)-5-[(4-hydroxycyclohexyl)amino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(=Cc2cnn3c(NC4CC4)cc(NC4CCC(O)CC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C20H24N6O3/c27-15-5-3-13(4-6-15)22-16-9-17(23-14-1-2-14)26-19(24-16)12(10-21-26)7-11-8-18(28)25-20(11)29/h7,9-10,13-15,23,27H,1-6,8H2,(H,22,24)(H,25,28,29) |
| InChIKey | GQJABUTWTXNXNK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 120.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|