C28H36N2O6 — CID 6705109
[(2S)-1-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate (PubChem CID 6705109) has the molecular formula C28H36N2O6 and a molecular weight of 496.60 g/mol. Its IUPAC name is [(2S)-1-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate.
| Compound Name | [(2S)-1-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 6705109 |
| Molecular Formula | C28H36N2O6 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | [(2S)-1-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate |
| SMILES | C=CCN(C)C[C@@H]1O[C@H](c2ccc(NC(=O)[C@H](C)OC(C)=O)cc2)OC(c2ccc(CO)cc2)[C@@H]1C |
| InChI | InChI=1S/C28H36N2O6/c1-6-15-30(5)16-25-18(2)26(22-9-7-21(17-31)8-10-22)36-28(35-25)23-11-13-24(14-12-23)29-27(33)19(3)34-20(4)32/h6-14,18-19,25-26,28,31H,1,15-17H2,2-5H3,(H,29,33)/t18-,19+,25+,26?,28+/m1/s1 |
| InChIKey | KJIWKSJCNSJERO-CBTPRGTFSA-N |
| XLogP | 3.98 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|