C14H14N6O4S — CID 67051441
3-[[4-(cyclopropylamino)-2-methylsulfonylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 67051441) has the molecular formula C14H14N6O4S and a molecular weight of 362.37 g/mol. Its IUPAC name is 3-[[4-(cyclopropylamino)-2-methylsulfonylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-[[4-(cyclopropylamino)-2-methylsulfonylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67051441 |
| Molecular Formula | C14H14N6O4S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 3-[[4-(cyclopropylamino)-2-methylsulfonylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CS(=O)(=O)c1nc(NC2CC2)n2ncc(C=C3CC(=O)NC3=O)c2n1 |
| InChI | InChI=1S/C14H14N6O4S/c1-25(23,24)14-18-11-8(4-7-5-10(21)17-12(7)22)6-15-20(11)13(19-14)16-9-2-3-9/h4,6,9H,2-3,5H2,1H3,(H,16,18,19)(H,17,21,22) |
| InChIKey | JJIOUIORTDNEBW-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|