C19H17FN6O3S — CID 67051450
3-[[4-[2-(3-fluorophenyl)ethylamino]-2-methylsulfinylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 67051450) has the molecular formula C19H17FN6O3S and a molecular weight of 428.45 g/mol. Its IUPAC name is 3-[[4-[2-(3-fluorophenyl)ethylamino]-2-methylsulfinylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-[[4-[2-(3-fluorophenyl)ethylamino]-2-methylsulfinylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67051450 |
| Molecular Formula | C19H17FN6O3S |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 3-[[4-[2-(3-fluorophenyl)ethylamino]-2-methylsulfinylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CS(=O)c1nc(NCCc2cccc(F)c2)n2ncc(C=C3CC(=O)NC3=O)c2n1 |
| InChI | InChI=1S/C19H17FN6O3S/c1-30(29)19-24-16-13(8-12-9-15(27)23-17(12)28)10-22-26(16)18(25-19)21-6-5-11-3-2-4-14(20)7-11/h2-4,7-8,10H,5-6,9H2,1H3,(H,21,24,25)(H,23,27,28) |
| InChIKey | SBXPLDBDBXTHKS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|