C17H17NO5 — CID 670515
N-(1,3-benzodioxol-5-ylmethyl)-3,4-dimethoxybenzamide (PubChem CID 670515) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3,4-dimethoxybenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 670515 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C17H17NO5/c1-20-13-6-4-12(8-15(13)21-2)17(19)18-9-11-3-5-14-16(7-11)23-10-22-14/h3-8H,9-10H2,1-2H3,(H,18,19) |
| InChIKey | XVLXQGFRLPIMRN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |