C40H47N3O6S — CID 6705159
(2R)-N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 6705159) has the molecular formula C40H47N3O6S and a molecular weight of 697.90 g/mol. Its IUPAC name is (2R)-N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (2R)-N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 6705159 |
| Molecular Formula | C40H47N3O6S |
| Molecular Weight | 697.90 g/mol |
| Exact Mass | 697.32 |
| IUPAC Name | (2R)-N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](Cc2ccccc2)C(=O)Nc2ccc([C@@H]3OC(c4ccc(CO)cc4)[C@H](C)[C@H](CN4CCCCC4)O3)cc2)cc1 |
| InChI | InChI=1S/C40H47N3O6S/c1-28-11-21-35(22-12-28)50(46,47)42-36(25-30-9-5-3-6-10-30)39(45)41-34-19-17-33(18-20-34)40-48-37(26-43-23-7-4-8-24-43)29(2)38(49-40)32-15-13-31(27-44)14-16-32/h3,5-6,9-22,29,36-38,40,42,44H,4,7-8,23-27H2,1-2H3,(H,41,45)/t29-,36-,37+,38?,40+/m1/s1 |
| InChIKey | AKXUNZWNNOKUQF-DMOLNGBGSA-N |
| XLogP | 6.29 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.90 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |