C20H17ClN6O3 — CID 67052240
3-[[5-(5-chloro-2-hydroxyanilino)-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 67052240) has the molecular formula C20H17ClN6O3 and a molecular weight of 424.85 g/mol. Its IUPAC name is 3-[[5-(5-chloro-2-hydroxyanilino)-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-[[5-(5-chloro-2-hydroxyanilino)-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67052240 |
| Molecular Formula | C20H17ClN6O3 |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 3-[[5-(5-chloro-2-hydroxyanilino)-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(=Cc2cnn3c(NC4CC4)cc(Nc4cc(Cl)ccc4O)nc23)C(=O)N1 |
| InChI | InChI=1S/C20H17ClN6O3/c21-12-1-4-15(28)14(7-12)24-16-8-17(23-13-2-3-13)27-19(25-16)11(9-22-27)5-10-6-18(29)26-20(10)30/h1,4-5,7-9,13,23,28H,2-3,6H2,(H,24,25)(H,26,29,30) |
| InChIKey | SKYVKGSDPBGEFB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 120.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|