About 2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol
2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol (PubChem CID 67052894) has the molecular formula C19H14ClFN2O
and a molecular weight of 340.79 g/mol. Its IUPAC name is 2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol.
Molecular Properties
| Compound Name | 2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol |
| PubChem CID | 67052894 |
| Molecular Formula | C19H14ClFN2O |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol |
| SMILES | OC1=C(c2ccccc2)CNc2cc(Cl)n(-c3ccc(F)cc3)c21 |
| InChI | InChI=1S/C19H14ClFN2O/c20-17-10-16-18(23(17)14-8-6-13(21)7-9-14)19(24)15(11-22-16)12-4-2-1-3-5-12/h1-10,22,24H,11H2 |
| InChIKey | XXSALYJVSAHYRG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol?
The IUPAC name of 2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol (CID 67052894) is 2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol.
What is the SMILES notation for 2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol?
The canonical SMILES for 2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol is OC1=C(c2ccccc2)CNc2cc(Cl)n(-c3ccc(F)cc3)c21.
What is the InChIKey of 2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol?
The InChIKey is XXSALYJVSAHYRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14ClFN2O/c20-17-10-16-18(23(17)14-8-6-13(21)7-9-14)19(24)15(11-22-16)12-4-2-1-3-5-12/h1-10,22,24H,11H2.
What are the key properties of 2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol?
2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol has a molecular weight of 340.79 g/mol, XLogP of 5.12, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-(4-fluorophenyl)-6-phenyl-4,5-dihydropyrrolo[3,2-b]pyridin-7-ol is sourced from PubChem (CID 67052894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).