About 2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine
2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine (PubChem CID 67053223) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine |
| PubChem CID | 67053223 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine |
| SMILES | CCOc1cc2ncc(N)cn2n1 |
| InChI | InChI=1S/C8H10N4O/c1-2-13-8-3-7-10-4-6(9)5-12(7)11-8/h3-5H,2,9H2,1H3 |
| InChIKey | NZXRLQXURQHYFM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine?
The IUPAC name of 2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine (CID 67053223) is 2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine.
What is the SMILES notation for 2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine?
The canonical SMILES for 2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine is CCOc1cc2ncc(N)cn2n1.
What is the InChIKey of 2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine?
The InChIKey is NZXRLQXURQHYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c1-2-13-8-3-7-10-4-6(9)5-12(7)11-8/h3-5H,2,9H2,1H3.
What are the key properties of 2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine?
2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine has a molecular weight of 178.19 g/mol, XLogP of 0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxypyrazolo[1,5-a]pyrimidin-6-amine is sourced from PubChem (CID 67053223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).