About 6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid
6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 67053550) has the molecular formula C7H5BrF2O2
and a molecular weight of 239.02 g/mol. Its IUPAC name is 6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 67053550 |
| Molecular Formula | C7H5BrF2O2 |
| Molecular Weight | 239.02 g/mol |
| Exact Mass | 237.94 |
| IUPAC Name | 6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1C(F)=CC=CC1(F)Br |
| InChI | InChI=1S/C7H5BrF2O2/c8-7(10)3-1-2-4(9)5(7)6(11)12/h1-3,5H,(H,11,12) |
| InChIKey | DCXILKZJSKRLLV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.02 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid (CID 67053550) is 6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1C(F)=CC=CC1(F)Br.
What is the InChIKey of 6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is DCXILKZJSKRLLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrF2O2/c8-7(10)3-1-2-4(9)5(7)6(11)12/h1-3,5H,(H,11,12).
What are the key properties of 6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid?
6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 239.02 g/mol, XLogP of 2.17, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,6-difluorocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 67053550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).