About 1,1'-biphenyl;ethane-1,2-diol;methoxymethane
1,1'-biphenyl;ethane-1,2-diol;methoxymethane (PubChem CID 67053670) has the molecular formula C16H22O3
and a molecular weight of 262.35 g/mol. Its IUPAC name is 1,1'-biphenyl;ethane-1,2-diol;methoxymethane.
Molecular Properties
| Compound Name | 1,1'-biphenyl;ethane-1,2-diol;methoxymethane |
| PubChem CID | 67053670 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 1,1'-biphenyl;ethane-1,2-diol;methoxymethane |
| SMILES | COC.OCCO.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C2H6O2.C2H6O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;3-1-2-4;1-3-2/h1-10H;3-4H,1-2H2;1-2H3 |
| InChIKey | QDWHCWFDOIDNEL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1'-biphenyl;ethane-1,2-diol;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;ethane-1,2-diol;methoxymethane?
The IUPAC name of 1,1'-biphenyl;ethane-1,2-diol;methoxymethane (CID 67053670) is 1,1'-biphenyl;ethane-1,2-diol;methoxymethane.
What is the SMILES notation for 1,1'-biphenyl;ethane-1,2-diol;methoxymethane?
The canonical SMILES for 1,1'-biphenyl;ethane-1,2-diol;methoxymethane is COC.OCCO.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;ethane-1,2-diol;methoxymethane?
The InChIKey is QDWHCWFDOIDNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C2H6O2.C2H6O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;3-1-2-4;1-3-2/h1-10H;3-4H,1-2H2;1-2H3.
What are the key properties of 1,1'-biphenyl;ethane-1,2-diol;methoxymethane?
1,1'-biphenyl;ethane-1,2-diol;methoxymethane has a molecular weight of 262.35 g/mol, XLogP of 2.59, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;ethane-1,2-diol;methoxymethane is sourced from PubChem (CID 67053670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).