C13H14N6O3 — CID 67054520
1-[2-amino-4-(2-methoxyethyl)-3-pyridinyl]-3,7-dihydropurine-2,6-dione (PubChem CID 67054520) has the molecular formula C13H14N6O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is 1-[2-amino-4-(2-methoxyethyl)-3-pyridinyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 1-[2-amino-4-(2-methoxyethyl)-3-pyridinyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 67054520 |
| Molecular Formula | C13H14N6O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-[2-amino-4-(2-methoxyethyl)-3-pyridinyl]-3,7-dihydropurine-2,6-dione |
| SMILES | COCCc1ccnc(N)c1-n1c(=O)[nH]c2nc[nH]c2c1=O |
| InChI | InChI=1S/C13H14N6O3/c1-22-5-3-7-2-4-15-10(14)9(7)19-12(20)8-11(17-6-16-8)18-13(19)21/h2,4,6H,3,5H2,1H3,(H2,14,15)(H,16,17)(H,18,21) |
| InChIKey | XQGVHGWVRDLPQZ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |