C31H28N4O4S — CID 67054538
(E)-1-[5-[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]isoindol-2-yl]hept-5-ene-1,4-dione (PubChem CID 67054538) has the molecular formula C31H28N4O4S and a molecular weight of 552.66 g/mol. Its IUPAC name is (E)-1-[5-[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]isoindol-2-yl]hept-5-ene-1,4-dione.
| Compound Name | (E)-1-[5-[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]isoindol-2-yl]hept-5-ene-1,4-dione |
|---|---|
| PubChem CID | 67054538 |
| Molecular Formula | C31H28N4O4S |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | (E)-1-[5-[2-(3-hydroxyphenyl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]isoindol-2-yl]hept-5-ene-1,4-dione |
| SMILES | C/C=C/C(=O)CCC(=O)n1cc2ccc(-c3cc4nc(-c5cccc(O)c5)nc(N5CCOCC5)c4s3)cc2c1 |
| InChI | InChI=1S/C31H28N4O4S/c1-2-4-24(36)9-10-28(38)35-18-22-8-7-20(15-23(22)19-35)27-17-26-29(40-27)31(34-11-13-39-14-12-34)33-30(32-26)21-5-3-6-25(37)16-21/h2-8,15-19,37H,9-14H2,1H3/b4-2+ |
| InChIKey | GLLQHNYSRQCLLX-DUXPYHPUSA-N |
| XLogP | 6.09 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|