About butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate
butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate (PubChem CID 67054586) has the molecular formula C25H42NO5P
and a molecular weight of 467.59 g/mol. Its IUPAC name is butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate.
Molecular Properties
| Compound Name | butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate |
| PubChem CID | 67054586 |
| Molecular Formula | C25H42NO5P |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate |
| SMILES | CCCCCCCCc1ccc(CCC2(COP(=O)(O)OC(C)CC)COC(C)=N2)cc1 |
| InChI | InChI=1S/C25H42NO5P/c1-5-7-8-9-10-11-12-23-13-15-24(16-14-23)17-18-25(19-29-22(4)26-25)20-30-32(27,28)31-21(3)6-2/h13-16,21H,5-12,17-20H2,1-4H3,(H,27,28) |
| InChIKey | DMMMAYHNPWZHAR-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate?
The IUPAC name of butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate (CID 67054586) is butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate.
What is the SMILES notation for butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate?
The canonical SMILES for butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate is CCCCCCCCc1ccc(CCC2(COP(=O)(O)OC(C)CC)COC(C)=N2)cc1.
What is the InChIKey of butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate?
The InChIKey is DMMMAYHNPWZHAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H42NO5P/c1-5-7-8-9-10-11-12-23-13-15-24(16-14-23)17-18-25(19-29-22(4)26-25)20-30-32(27,28)31-21(3)6-2/h13-16,21H,5-12,17-20H2,1-4H3,(H,27,28).
What are the key properties of butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate?
butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate has a molecular weight of 467.59 g/mol, XLogP of 6.64, 16 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl [2-methyl-4-[2-(4-octylphenyl)ethyl]-5H-1,3-oxazol-4-yl]methyl hydrogen phosphate is sourced from PubChem (CID 67054586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).